C22H26FN3O — CID 134545770
(8S)-5-(2-fluorophenyl)-11,11-dimethyl-N-(2-methylpropyl)-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-triene-1-carboxamide (PubChem CID 134545770) has the molecular formula C22H26FN3O and a molecular weight of 367.47 g/mol. Its IUPAC name is (8S)-5-(2-fluorophenyl)-11,11-dimethyl-N-(2-methylpropyl)-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-triene-1-carboxamide.
| Compound Name | (8S)-5-(2-fluorophenyl)-11,11-dimethyl-N-(2-methylpropyl)-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-triene-1-carboxamide |
|---|---|
| PubChem CID | 134545770 |
| Molecular Formula | C22H26FN3O |
| Molecular Weight | 367.47 g/mol |
| Exact Mass | 367.21 |
| IUPAC Name | (8S)-5-(2-fluorophenyl)-11,11-dimethyl-N-(2-methylpropyl)-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-triene-1-carboxamide |
| SMILES | CC(C)CNC(=O)C12CC[C@H](c3cc(-c4ccccc4F)nnc31)C2(C)C |
| InChI | InChI=1S/C22H26FN3O/c1-13(2)12-24-20(27)22-10-9-16(21(22,3)4)15-11-18(25-26-19(15)22)14-7-5-6-8-17(14)23/h5-8,11,13,16H,9-10,12H2,1-4H3,(H,24,27)/t16-,22?/m1/s1 |
| InChIKey | YQSKYRTZPDYKCE-XESZBRCGSA-N |
| XLogP | 4.21 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.47 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |