C21H19F4N3O — CID 123616324
(3,3-difluoroazetidin-1-yl)-[5-(2,6-difluorophenyl)-11,11-dimethyl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-trien-1-yl]methanone (PubChem CID 123616324) has the molecular formula C21H19F4N3O and a molecular weight of 405.40 g/mol. Its IUPAC name is (3,3-difluoroazetidin-1-yl)-[5-(2,6-difluorophenyl)-11,11-dimethyl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-trien-1-yl]methanone.
| Compound Name | (3,3-difluoroazetidin-1-yl)-[5-(2,6-difluorophenyl)-11,11-dimethyl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-trien-1-yl]methanone |
|---|---|
| PubChem CID | 123616324 |
| Molecular Formula | C21H19F4N3O |
| Molecular Weight | 405.40 g/mol |
| Exact Mass | 405.15 |
| IUPAC Name | (3,3-difluoroazetidin-1-yl)-[5-(2,6-difluorophenyl)-11,11-dimethyl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-trien-1-yl]methanone |
| SMILES | CC1(C)C2CCC1(C(=O)N1CC(F)(F)C1)c1nnc(-c3c(F)cccc3F)cc12 |
| InChI | InChI=1S/C21H19F4N3O/c1-19(2)12-6-7-21(19,18(29)28-9-20(24,25)10-28)17-11(12)8-15(26-27-17)16-13(22)4-3-5-14(16)23/h3-5,8,12H,6-7,9-10H2,1-2H3 |
| InChIKey | LBTVWPRCAOLDPA-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.40 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |