C21H21F2N3O — CID 134545402
azetidin-1-yl-[(8S)-5-(2,6-difluorophenyl)-11,11-dimethyl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-trien-1-yl]methanone (PubChem CID 134545402) has the molecular formula C21H21F2N3O and a molecular weight of 369.42 g/mol. Its IUPAC name is azetidin-1-yl-[(8S)-5-(2,6-difluorophenyl)-11,11-dimethyl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-trien-1-yl]methanone.
| Compound Name | azetidin-1-yl-[(8S)-5-(2,6-difluorophenyl)-11,11-dimethyl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-trien-1-yl]methanone |
|---|---|
| PubChem CID | 134545402 |
| Molecular Formula | C21H21F2N3O |
| Molecular Weight | 369.42 g/mol |
| Exact Mass | 369.17 |
| IUPAC Name | azetidin-1-yl-[(8S)-5-(2,6-difluorophenyl)-11,11-dimethyl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-trien-1-yl]methanone |
| SMILES | CC1(C)[C@@H]2CCC1(C(=O)N1CCC1)c1nnc(-c3c(F)cccc3F)cc12 |
| InChI | InChI=1S/C21H21F2N3O/c1-20(2)13-7-8-21(20,19(27)26-9-4-10-26)18-12(13)11-16(24-25-18)17-14(22)5-3-6-15(17)23/h3,5-6,11,13H,4,7-10H2,1-2H3/t13-,21?/m1/s1 |
| InChIKey | KKEQWTUFBRXHRB-ILRUXTBWSA-N |
| XLogP | 3.81 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.42 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |