C23H25F2N3O2 — CID 118044528
[(1S,8S)-5-(2,6-difluorophenyl)-11,11-dimethyl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-trien-1-yl]-(3-hydroxy-3-methylpyrrolidin-1-yl)methanone (PubChem CID 118044528) has the molecular formula C23H25F2N3O2 and a molecular weight of 413.47 g/mol. Its IUPAC name is [(1S,8S)-5-(2,6-difluorophenyl)-11,11-dimethyl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-trien-1-yl]-(3-hydroxy-3-methylpyrrolidin-1-yl)methanone.
| Compound Name | [(1S,8S)-5-(2,6-difluorophenyl)-11,11-dimethyl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-trien-1-yl]-(3-hydroxy-3-methylpyrrolidin-1-yl)methanone |
|---|---|
| PubChem CID | 118044528 |
| Molecular Formula | C23H25F2N3O2 |
| Molecular Weight | 413.47 g/mol |
| Exact Mass | 413.19 |
| IUPAC Name | [(1S,8S)-5-(2,6-difluorophenyl)-11,11-dimethyl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-trien-1-yl]-(3-hydroxy-3-methylpyrrolidin-1-yl)methanone |
| SMILES | CC1(O)CCN(C(=O)[C@]23CC[C@H](c4cc(-c5c(F)cccc5F)nnc42)C3(C)C)C1 |
| InChI | InChI=1S/C23H25F2N3O2/c1-21(2)14-7-8-23(21,20(29)28-10-9-22(3,30)12-28)19-13(14)11-17(26-27-19)18-15(24)5-4-6-16(18)25/h4-6,11,14,30H,7-10,12H2,1-3H3/t14-,22?,23+/m1/s1 |
| InChIKey | WLLQBTBYAJRECR-MMPPVAAOSA-N |
| XLogP | 3.56 |
| TPSA | 66.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.47 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |