C24H27F2N3O2 — CID 118044950
[(1S,8S)-5-(2,6-difluorophenyl)-11,11-dimethyl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-trien-1-yl]-[3-(2-hydroxyethyl)pyrrolidin-1-yl]methanone (PubChem CID 118044950) has the molecular formula C24H27F2N3O2 and a molecular weight of 427.50 g/mol. Its IUPAC name is [(1S,8S)-5-(2,6-difluorophenyl)-11,11-dimethyl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-trien-1-yl]-[3-(2-hydroxyethyl)pyrrolidin-1-yl]methanone.
| Compound Name | [(1S,8S)-5-(2,6-difluorophenyl)-11,11-dimethyl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-trien-1-yl]-[3-(2-hydroxyethyl)pyrrolidin-1-yl]methanone |
|---|---|
| PubChem CID | 118044950 |
| Molecular Formula | C24H27F2N3O2 |
| Molecular Weight | 427.50 g/mol |
| Exact Mass | 427.21 |
| IUPAC Name | [(1S,8S)-5-(2,6-difluorophenyl)-11,11-dimethyl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-trien-1-yl]-[3-(2-hydroxyethyl)pyrrolidin-1-yl]methanone |
| SMILES | CC1(C)[C@@H]2CC[C@@]1(C(=O)N1CCC(CCO)C1)c1nnc(-c3c(F)cccc3F)cc12 |
| InChI | InChI=1S/C24H27F2N3O2/c1-23(2)16-6-9-24(23,22(31)29-10-7-14(13-29)8-11-30)21-15(16)12-19(27-28-21)20-17(25)4-3-5-18(20)26/h3-5,12,14,16,30H,6-11,13H2,1-2H3/t14?,16-,24+/m1/s1 |
| InChIKey | FBSJOTTVULRSTR-GSTLOAEASA-N |
| XLogP | 3.81 |
| TPSA | 66.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.50 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |