C24H27F2N3O4 — CID 134262386
1-[(2S)-2-[(1R,8R)-5-(2,6-difluorophenyl)-11,11-dimethyl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-trien-1-yl]morpholin-4-yl]-2,3-dihydroxypropan-1-one (PubChem CID 134262386) has the molecular formula C24H27F2N3O4 and a molecular weight of 459.49 g/mol. Its IUPAC name is 1-[(2S)-2-[(1R,8R)-5-(2,6-difluorophenyl)-11,11-dimethyl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-trien-1-yl]morpholin-4-yl]-2,3-dihydroxypropan-1-one.
| Compound Name | 1-[(2S)-2-[(1R,8R)-5-(2,6-difluorophenyl)-11,11-dimethyl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-trien-1-yl]morpholin-4-yl]-2,3-dihydroxypropan-1-one |
|---|---|
| PubChem CID | 134262386 |
| Molecular Formula | C24H27F2N3O4 |
| Molecular Weight | 459.49 g/mol |
| Exact Mass | 459.20 |
| IUPAC Name | 1-[(2S)-2-[(1R,8R)-5-(2,6-difluorophenyl)-11,11-dimethyl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-trien-1-yl]morpholin-4-yl]-2,3-dihydroxypropan-1-one |
| SMILES | CC1(C)[C@H]2CC[C@]1([C@H]1CN(C(=O)C(O)CO)CCO1)c1nnc(-c3c(F)cccc3F)cc12 |
| InChI | InChI=1S/C24H27F2N3O4/c1-23(2)14-6-7-24(23,19-11-29(8-9-33-19)22(32)18(31)12-30)21-13(14)10-17(27-28-21)20-15(25)4-3-5-16(20)26/h3-5,10,14,18-19,30-31H,6-9,11-12H2,1-2H3/t14-,18?,19+,24-/m0/s1 |
| InChIKey | RNBHXZYICJAVFL-GHNIUEGXSA-N |
| XLogP | 2.16 |
| TPSA | 95.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.49 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |