C27H26F2N4O3 — CID 160589948
6-[(2S)-2-[(1R,8R)-5-(2,6-difluorophenyl)-11,11-dimethyl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-trien-1-yl]morpholine-4-carbonyl]-4H-pyridin-3-one (PubChem CID 160589948) has the molecular formula C27H26F2N4O3 and a molecular weight of 492.53 g/mol. Its IUPAC name is 6-[(2S)-2-[(1R,8R)-5-(2,6-difluorophenyl)-11,11-dimethyl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-trien-1-yl]morpholine-4-carbonyl]-4H-pyridin-3-one.
| Compound Name | 6-[(2S)-2-[(1R,8R)-5-(2,6-difluorophenyl)-11,11-dimethyl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-trien-1-yl]morpholine-4-carbonyl]-4H-pyridin-3-one |
|---|---|
| PubChem CID | 160589948 |
| Molecular Formula | C27H26F2N4O3 |
| Molecular Weight | 492.53 g/mol |
| Exact Mass | 492.20 |
| IUPAC Name | 6-[(2S)-2-[(1R,8R)-5-(2,6-difluorophenyl)-11,11-dimethyl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-trien-1-yl]morpholine-4-carbonyl]-4H-pyridin-3-one |
| SMILES | CC1(C)[C@H]2CC[C@]1([C@H]1CN(C(=O)C3=CCC(=O)C=N3)CCO1)c1nnc(-c3c(F)cccc3F)cc12 |
| InChI | InChI=1S/C27H26F2N4O3/c1-26(2)17-8-9-27(26,22-14-33(10-11-36-22)25(35)20-7-6-15(34)13-30-20)24-16(17)12-21(31-32-24)23-18(28)4-3-5-19(23)29/h3-5,7,12-13,17,22H,6,8-11,14H2,1-2H3/t17-,22+,27-/m0/s1 |
| InChIKey | RCWOJQQFWKQWJE-UWMNEONRSA-N |
| XLogP | 3.73 |
| TPSA | 84.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.53 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |