C25H26F2N4O3 — CID 134273969
[2-[(2R)-2-[(1R,8R)-5-(2,6-difluorophenyl)-11,11-dimethyl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-trien-1-yl]morpholin-4-yl]-1,3-oxazol-4-yl]methanol (PubChem CID 134273969) has the molecular formula C25H26F2N4O3 and a molecular weight of 468.50 g/mol. Its IUPAC name is [2-[(2R)-2-[(1R,8R)-5-(2,6-difluorophenyl)-11,11-dimethyl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-trien-1-yl]morpholin-4-yl]-1,3-oxazol-4-yl]methanol.
| Compound Name | [2-[(2R)-2-[(1R,8R)-5-(2,6-difluorophenyl)-11,11-dimethyl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-trien-1-yl]morpholin-4-yl]-1,3-oxazol-4-yl]methanol |
|---|---|
| PubChem CID | 134273969 |
| Molecular Formula | C25H26F2N4O3 |
| Molecular Weight | 468.50 g/mol |
| Exact Mass | 468.20 |
| IUPAC Name | [2-[(2R)-2-[(1R,8R)-5-(2,6-difluorophenyl)-11,11-dimethyl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-trien-1-yl]morpholin-4-yl]-1,3-oxazol-4-yl]methanol |
| SMILES | CC1(C)[C@H]2CC[C@]1([C@@H]1CN(c3nc(CO)co3)CCO1)c1nnc(-c3c(F)cccc3F)cc12 |
| InChI | InChI=1S/C25H26F2N4O3/c1-24(2)16-6-7-25(24,20-11-31(8-9-33-20)23-28-14(12-32)13-34-23)22-15(16)10-19(29-30-22)21-17(26)4-3-5-18(21)27/h3-5,10,13,16,20,32H,6-9,11-12H2,1-2H3/t16-,20-,25-/m0/s1 |
| InChIKey | CTDZXCIKGUIMNE-BLRRAGTOSA-N |
| XLogP | 3.96 |
| TPSA | 84.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.50 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |