C22H25F2N3 — CID 134273911
(1S,8R)-5-(2,6-difluorophenyl)-11,11-dimethyl-1-piperidin-2-yl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-triene (PubChem CID 134273911) has the molecular formula C22H25F2N3 and a molecular weight of 369.46 g/mol. Its IUPAC name is (1S,8R)-5-(2,6-difluorophenyl)-11,11-dimethyl-1-piperidin-2-yl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-triene.
| Compound Name | (1S,8R)-5-(2,6-difluorophenyl)-11,11-dimethyl-1-piperidin-2-yl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-triene |
|---|---|
| PubChem CID | 134273911 |
| Molecular Formula | C22H25F2N3 |
| Molecular Weight | 369.46 g/mol |
| Exact Mass | 369.20 |
| IUPAC Name | (1S,8R)-5-(2,6-difluorophenyl)-11,11-dimethyl-1-piperidin-2-yl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-triene |
| SMILES | CC1(C)[C@H]2CC[C@]1(C1CCCCN1)c1nnc(-c3c(F)cccc3F)cc12 |
| InChI | InChI=1S/C22H25F2N3/c1-21(2)14-9-10-22(21,18-8-3-4-11-25-18)20-13(14)12-17(26-27-20)19-15(23)6-5-7-16(19)24/h5-7,12,14,18,25H,3-4,8-11H2,1-2H3/t14-,18?,22-/m0/s1 |
| InChIKey | NBCFNFFEJOZVQR-KZJHALPUSA-N |
| XLogP | 4.72 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.46 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |