C17H17F2N3 — CID 122683453
(1S,8S)-5-(2,6-difluorophenyl)-11,11-dimethyl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-trien-1-amine (PubChem CID 122683453) has the molecular formula C17H17F2N3 and a molecular weight of 301.34 g/mol. Its IUPAC name is (1S,8S)-5-(2,6-difluorophenyl)-11,11-dimethyl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-trien-1-amine.
| Compound Name | (1S,8S)-5-(2,6-difluorophenyl)-11,11-dimethyl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-trien-1-amine |
|---|---|
| PubChem CID | 122683453 |
| Molecular Formula | C17H17F2N3 |
| Molecular Weight | 301.34 g/mol |
| Exact Mass | 301.14 |
| IUPAC Name | (1S,8S)-5-(2,6-difluorophenyl)-11,11-dimethyl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-trien-1-amine |
| SMILES | CC1(C)[C@@H]2CC[C@@]1(N)c1nnc(-c3c(F)cccc3F)cc12 |
| InChI | InChI=1S/C17H17F2N3/c1-16(2)10-6-7-17(16,20)15-9(10)8-13(21-22-15)14-11(18)4-3-5-12(14)19/h3-5,8,10H,6-7,20H2,1-2H3/t10-,17-/m1/s1 |
| InChIKey | ILYBGSDKLMMLRB-BMLIUANNSA-N |
| XLogP | 3.49 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.34 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |