C19H17BrF2N2O — CID 122683680
2-bromo-1-[(1R)-5-(2,6-difluorophenyl)-11,11-dimethyl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-trien-1-yl]ethanone (PubChem CID 122683680) has the molecular formula C19H17BrF2N2O and a molecular weight of 407.26 g/mol. Its IUPAC name is 2-bromo-1-[(1R)-5-(2,6-difluorophenyl)-11,11-dimethyl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-trien-1-yl]ethanone.
| Compound Name | 2-bromo-1-[(1R)-5-(2,6-difluorophenyl)-11,11-dimethyl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-trien-1-yl]ethanone |
|---|---|
| PubChem CID | 122683680 |
| Molecular Formula | C19H17BrF2N2O |
| Molecular Weight | 407.26 g/mol |
| Exact Mass | 406.05 |
| IUPAC Name | 2-bromo-1-[(1R)-5-(2,6-difluorophenyl)-11,11-dimethyl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-trien-1-yl]ethanone |
| SMILES | CC1(C)C2CC[C@]1(C(=O)CBr)c1nnc(-c3c(F)cccc3F)cc12 |
| InChI | InChI=1S/C19H17BrF2N2O/c1-18(2)11-6-7-19(18,15(25)9-20)17-10(11)8-14(23-24-17)16-12(21)4-3-5-13(16)22/h3-5,8,11H,6-7,9H2,1-2H3/t11?,19-/m0/s1 |
| InChIKey | IKBMDQPYCLCKMJ-OWRIGNJKSA-N |
| XLogP | 4.54 |
| TPSA | 42.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.26 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|