C21H23F2N3O2 — CID 134262376
(2R)-2-[[5-(2,6-difluorophenyl)-11,11-dimethyl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-trien-1-yl]oxy]butanamide (PubChem CID 134262376) has the molecular formula C21H23F2N3O2 and a molecular weight of 387.43 g/mol. Its IUPAC name is (2R)-2-[[5-(2,6-difluorophenyl)-11,11-dimethyl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-trien-1-yl]oxy]butanamide.
| Compound Name | (2R)-2-[[5-(2,6-difluorophenyl)-11,11-dimethyl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-trien-1-yl]oxy]butanamide |
|---|---|
| PubChem CID | 134262376 |
| Molecular Formula | C21H23F2N3O2 |
| Molecular Weight | 387.43 g/mol |
| Exact Mass | 387.18 |
| IUPAC Name | (2R)-2-[[5-(2,6-difluorophenyl)-11,11-dimethyl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-trien-1-yl]oxy]butanamide |
| SMILES | CC[C@@H](OC12CCC(c3cc(-c4c(F)cccc4F)nnc31)C2(C)C)C(N)=O |
| InChI | InChI=1S/C21H23F2N3O2/c1-4-16(19(24)27)28-21-9-8-12(20(21,2)3)11-10-15(25-26-18(11)21)17-13(22)6-5-7-14(17)23/h5-7,10,12,16H,4,8-9H2,1-3H3,(H2,24,27)/t12?,16-,21?/m1/s1 |
| InChIKey | MRGCBORGHJAORG-MNHIZXKVSA-N |
| XLogP | 3.81 |
| TPSA | 78.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.43 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |