C21H21F2N3O2 — CID 122683618
1-[[(1R,8S)-5-(2,6-difluorophenyl)-11,11-dimethyl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-trien-1-yl]oxy]cyclopropane-1-carboxamide (PubChem CID 122683618) has the molecular formula C21H21F2N3O2 and a molecular weight of 385.41 g/mol. Its IUPAC name is 1-[[(1R,8S)-5-(2,6-difluorophenyl)-11,11-dimethyl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-trien-1-yl]oxy]cyclopropane-1-carboxamide.
| Compound Name | 1-[[(1R,8S)-5-(2,6-difluorophenyl)-11,11-dimethyl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-trien-1-yl]oxy]cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 122683618 |
| Molecular Formula | C21H21F2N3O2 |
| Molecular Weight | 385.41 g/mol |
| Exact Mass | 385.16 |
| IUPAC Name | 1-[[(1R,8S)-5-(2,6-difluorophenyl)-11,11-dimethyl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-trien-1-yl]oxy]cyclopropane-1-carboxamide |
| SMILES | CC1(C)[C@H]2CC[C@]1(OC1(C(N)=O)CC1)c1nnc(-c3c(F)cccc3F)cc12 |
| InChI | InChI=1S/C21H21F2N3O2/c1-19(2)12-6-7-21(19,28-20(8-9-20)18(24)27)17-11(12)10-15(25-26-17)16-13(22)4-3-5-14(16)23/h3-5,10,12H,6-9H2,1-2H3,(H2,24,27)/t12-,21-/m0/s1 |
| InChIKey | WOQNRDWHRTXJCS-QKVFXAPYSA-N |
| XLogP | 3.57 |
| TPSA | 78.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.41 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |