C23H27F2N3O2 — CID 122683714
(2R)-2-[[(1R,8S)-5-(2,6-difluorophenyl)-11,11-dimethyl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-trien-1-yl]oxy]-N-ethylbutanamide (PubChem CID 122683714) has the molecular formula C23H27F2N3O2 and a molecular weight of 415.48 g/mol. Its IUPAC name is (2R)-2-[[(1R,8S)-5-(2,6-difluorophenyl)-11,11-dimethyl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-trien-1-yl]oxy]-N-ethylbutanamide.
| Compound Name | (2R)-2-[[(1R,8S)-5-(2,6-difluorophenyl)-11,11-dimethyl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-trien-1-yl]oxy]-N-ethylbutanamide |
|---|---|
| PubChem CID | 122683714 |
| Molecular Formula | C23H27F2N3O2 |
| Molecular Weight | 415.48 g/mol |
| Exact Mass | 415.21 |
| IUPAC Name | (2R)-2-[[(1R,8S)-5-(2,6-difluorophenyl)-11,11-dimethyl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-trien-1-yl]oxy]-N-ethylbutanamide |
| SMILES | CCNC(=O)[C@@H](CC)O[C@@]12CC[C@@H](c3cc(-c4c(F)cccc4F)nnc31)C2(C)C |
| InChI | InChI=1S/C23H27F2N3O2/c1-5-18(21(29)26-6-2)30-23-11-10-14(22(23,3)4)13-12-17(27-28-20(13)23)19-15(24)8-7-9-16(19)25/h7-9,12,14,18H,5-6,10-11H2,1-4H3,(H,26,29)/t14-,18+,23-/m0/s1 |
| InChIKey | KTYCPQFRDWJNDQ-IJRIMCCZSA-N |
| XLogP | 4.47 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.48 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |