C23H26F2N4O — CID 145182884
N-[(1S)-1-[(1S,8R)-5-(2,6-difluorophenyl)-11,11-dimethyl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-trien-1-yl]ethyl]-2-methyliminopropanamide (PubChem CID 145182884) has the molecular formula C23H26F2N4O and a molecular weight of 412.48 g/mol. Its IUPAC name is N-[(1S)-1-[(1S,8R)-5-(2,6-difluorophenyl)-11,11-dimethyl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-trien-1-yl]ethyl]-2-methyliminopropanamide.
| Compound Name | N-[(1S)-1-[(1S,8R)-5-(2,6-difluorophenyl)-11,11-dimethyl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-trien-1-yl]ethyl]-2-methyliminopropanamide |
|---|---|
| PubChem CID | 145182884 |
| Molecular Formula | C23H26F2N4O |
| Molecular Weight | 412.48 g/mol |
| Exact Mass | 412.21 |
| IUPAC Name | N-[(1S)-1-[(1S,8R)-5-(2,6-difluorophenyl)-11,11-dimethyl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-trien-1-yl]ethyl]-2-methyliminopropanamide |
| SMILES | C/N=C(\C)C(=O)N[C@@H](C)[C@@]12CC[C@@H](c3cc(-c4c(F)cccc4F)nnc31)C2(C)C |
| InChI | InChI=1S/C23H26F2N4O/c1-12(26-5)21(30)27-13(2)23-10-9-15(22(23,3)4)14-11-18(28-29-20(14)23)19-16(24)7-6-8-17(19)25/h6-8,11,13,15H,9-10H2,1-5H3,(H,27,30)/b26-12+/t13-,15-,23-/m0/s1 |
| InChIKey | DLXDEHMXVVBTMR-BEUCKYEVSA-N |
| XLogP | 4.17 |
| TPSA | 67.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.48 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|