C23H25F2N3O — CID 139432275
(E)-1-[(1R,8R)-5-(2,6-difluorophenyl)-11,11-dimethyl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-trien-1-yl]-3-(dimethylamino)-2-methylprop-2-en-1-one (PubChem CID 139432275) has the molecular formula C23H25F2N3O and a molecular weight of 397.47 g/mol. Its IUPAC name is (E)-1-[(1R,8R)-5-(2,6-difluorophenyl)-11,11-dimethyl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-trien-1-yl]-3-(dimethylamino)-2-methylprop-2-en-1-one.
| Compound Name | (E)-1-[(1R,8R)-5-(2,6-difluorophenyl)-11,11-dimethyl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-trien-1-yl]-3-(dimethylamino)-2-methylprop-2-en-1-one |
|---|---|
| PubChem CID | 139432275 |
| Molecular Formula | C23H25F2N3O |
| Molecular Weight | 397.47 g/mol |
| Exact Mass | 397.20 |
| IUPAC Name | (E)-1-[(1R,8R)-5-(2,6-difluorophenyl)-11,11-dimethyl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-trien-1-yl]-3-(dimethylamino)-2-methylprop-2-en-1-one |
| SMILES | C/C(=C\N(C)C)C(=O)[C@@]12CC[C@@H](c3cc(-c4c(F)cccc4F)nnc31)C2(C)C |
| InChI | InChI=1S/C23H25F2N3O/c1-13(12-28(4)5)21(29)23-10-9-15(22(23,2)3)14-11-18(26-27-20(14)23)19-16(24)7-6-8-17(19)25/h6-8,11-12,15H,9-10H2,1-5H3/b13-12+/t15-,23+/m0/s1 |
| InChIKey | SMGLINGZAMWZHH-DFRZLAMLSA-N |
| XLogP | 4.61 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.47 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|