C28H27F2N3O2 — CID 118044909
[(1R,8R)-5-(2,6-difluorophenyl)-11,11-dimethyl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-trien-1-yl]-(3-phenylmethoxyazetidin-1-yl)methanone (PubChem CID 118044909) has the molecular formula C28H27F2N3O2 and a molecular weight of 475.54 g/mol. Its IUPAC name is [(1R,8R)-5-(2,6-difluorophenyl)-11,11-dimethyl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-trien-1-yl]-(3-phenylmethoxyazetidin-1-yl)methanone.
| Compound Name | [(1R,8R)-5-(2,6-difluorophenyl)-11,11-dimethyl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-trien-1-yl]-(3-phenylmethoxyazetidin-1-yl)methanone |
|---|---|
| PubChem CID | 118044909 |
| Molecular Formula | C28H27F2N3O2 |
| Molecular Weight | 475.54 g/mol |
| Exact Mass | 475.21 |
| IUPAC Name | [(1R,8R)-5-(2,6-difluorophenyl)-11,11-dimethyl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-trien-1-yl]-(3-phenylmethoxyazetidin-1-yl)methanone |
| SMILES | CC1(C)[C@H]2CC[C@]1(C(=O)N1CC(OCc3ccccc3)C1)c1nnc(-c3c(F)cccc3F)cc12 |
| InChI | InChI=1S/C28H27F2N3O2/c1-27(2)20-11-12-28(27,26(34)33-14-18(15-33)35-16-17-7-4-3-5-8-17)25-19(20)13-23(31-32-25)24-21(29)9-6-10-22(24)30/h3-10,13,18,20H,11-12,14-16H2,1-2H3/t20-,28+/m0/s1 |
| InChIKey | LFKZQNWRAZENNJ-WTYVLRPYSA-N |
| XLogP | 5.00 |
| TPSA | 55.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.54 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |