C25H30F2N4O2 — CID 122683778
(3R)-3-[(1R,8R)-5-(2,6-difluorophenyl)-11,11-dimethyl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-trien-1-yl]-N-(2-hydroxyethyl)piperidine-1-carboxamide (PubChem CID 122683778) has the molecular formula C25H30F2N4O2 and a molecular weight of 456.54 g/mol. Its IUPAC name is (3R)-3-[(1R,8R)-5-(2,6-difluorophenyl)-11,11-dimethyl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-trien-1-yl]-N-(2-hydroxyethyl)piperidine-1-carboxamide.
| Compound Name | (3R)-3-[(1R,8R)-5-(2,6-difluorophenyl)-11,11-dimethyl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-trien-1-yl]-N-(2-hydroxyethyl)piperidine-1-carboxamide |
|---|---|
| PubChem CID | 122683778 |
| Molecular Formula | C25H30F2N4O2 |
| Molecular Weight | 456.54 g/mol |
| Exact Mass | 456.23 |
| IUPAC Name | (3R)-3-[(1R,8R)-5-(2,6-difluorophenyl)-11,11-dimethyl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-trien-1-yl]-N-(2-hydroxyethyl)piperidine-1-carboxamide |
| SMILES | CC1(C)[C@H]2CC[C@]1([C@H]1CCCN(C(=O)NCCO)C1)c1nnc(-c3c(F)cccc3F)cc12 |
| InChI | InChI=1S/C25H30F2N4O2/c1-24(2)17-8-9-25(24,15-5-4-11-31(14-15)23(33)28-10-12-32)22-16(17)13-20(29-30-22)21-18(26)6-3-7-19(21)27/h3,6-7,13,15,17,32H,4-5,8-12,14H2,1-2H3,(H,28,33)/t15-,17-,25-/m0/s1 |
| InChIKey | ROZKLHYMRFGGNY-RTNKVPBISA-N |
| XLogP | 3.99 |
| TPSA | 78.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.54 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |