C26H27F2N5 — CID 155049264
(8R)-5-(2,6-difluorophenyl)-11,11-dimethyl-1-[(3R)-1-pyrazin-2-ylpiperidin-3-yl]-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-triene (PubChem CID 155049264) has the molecular formula C26H27F2N5 and a molecular weight of 447.53 g/mol. Its IUPAC name is (8R)-5-(2,6-difluorophenyl)-11,11-dimethyl-1-[(3R)-1-pyrazin-2-ylpiperidin-3-yl]-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-triene.
| Compound Name | (8R)-5-(2,6-difluorophenyl)-11,11-dimethyl-1-[(3R)-1-pyrazin-2-ylpiperidin-3-yl]-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-triene |
|---|---|
| PubChem CID | 155049264 |
| Molecular Formula | C26H27F2N5 |
| Molecular Weight | 447.53 g/mol |
| Exact Mass | 447.22 |
| IUPAC Name | (8R)-5-(2,6-difluorophenyl)-11,11-dimethyl-1-[(3R)-1-pyrazin-2-ylpiperidin-3-yl]-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-triene |
| SMILES | CC1(C)[C@H]2CCC1([C@H]1CCCN(c3cnccn3)C1)c1nnc(-c3c(F)cccc3F)cc12 |
| InChI | InChI=1S/C26H27F2N5/c1-25(2)18-8-9-26(25,16-5-4-12-33(15-16)22-14-29-10-11-30-22)24-17(18)13-21(31-32-24)23-19(27)6-3-7-20(23)28/h3,6-7,10-11,13-14,16,18H,4-5,8-9,12,15H2,1-2H3/t16-,18-,26?/m0/s1 |
| InChIKey | WYCFZSNFPSFNBN-WMSNQLKKSA-N |
| XLogP | 5.28 |
| TPSA | 54.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.53 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |