C22H24F2N4O2 — CID 134262423
2-[(1S,8R)-5-(2,6-difluorophenyl)-11,11-dimethyl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-trien-1-yl]piperazine-1-carboxylic acid (PubChem CID 134262423) has the molecular formula C22H24F2N4O2 and a molecular weight of 414.46 g/mol. Its IUPAC name is 2-[(1S,8R)-5-(2,6-difluorophenyl)-11,11-dimethyl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-trien-1-yl]piperazine-1-carboxylic acid.
| Compound Name | 2-[(1S,8R)-5-(2,6-difluorophenyl)-11,11-dimethyl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-trien-1-yl]piperazine-1-carboxylic acid |
|---|---|
| PubChem CID | 134262423 |
| Molecular Formula | C22H24F2N4O2 |
| Molecular Weight | 414.46 g/mol |
| Exact Mass | 414.19 |
| IUPAC Name | 2-[(1S,8R)-5-(2,6-difluorophenyl)-11,11-dimethyl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-trien-1-yl]piperazine-1-carboxylic acid |
| SMILES | CC1(C)[C@H]2CC[C@]1(C1CNCCN1C(=O)O)c1nnc(-c3c(F)cccc3F)cc12 |
| InChI | InChI=1S/C22H24F2N4O2/c1-21(2)13-6-7-22(21,17-11-25-8-9-28(17)20(29)30)19-12(13)10-16(26-27-19)18-14(23)4-3-5-15(18)24/h3-5,10,13,17,25H,6-9,11H2,1-2H3,(H,29,30)/t13-,17?,22-/m0/s1 |
| InChIKey | RNOSHRKGUUGBJD-SSJNCOEUSA-N |
| XLogP | 3.53 |
| TPSA | 78.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.46 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |