C26H30F2N4O2 — CID 122683812
(3R)-3-[(1R,8R)-5-(2,6-difluorophenyl)-11,11-dimethyl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-trien-1-yl]-N-(oxetan-3-yl)piperidine-1-carboxamide (PubChem CID 122683812) has the molecular formula C26H30F2N4O2 and a molecular weight of 468.55 g/mol. Its IUPAC name is (3R)-3-[(1R,8R)-5-(2,6-difluorophenyl)-11,11-dimethyl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-trien-1-yl]-N-(oxetan-3-yl)piperidine-1-carboxamide.
| Compound Name | (3R)-3-[(1R,8R)-5-(2,6-difluorophenyl)-11,11-dimethyl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-trien-1-yl]-N-(oxetan-3-yl)piperidine-1-carboxamide |
|---|---|
| PubChem CID | 122683812 |
| Molecular Formula | C26H30F2N4O2 |
| Molecular Weight | 468.55 g/mol |
| Exact Mass | 468.23 |
| IUPAC Name | (3R)-3-[(1R,8R)-5-(2,6-difluorophenyl)-11,11-dimethyl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-trien-1-yl]-N-(oxetan-3-yl)piperidine-1-carboxamide |
| SMILES | CC1(C)[C@H]2CC[C@]1([C@H]1CCCN(C(=O)NC3COC3)C1)c1nnc(-c3c(F)cccc3F)cc12 |
| InChI | InChI=1S/C26H30F2N4O2/c1-25(2)18-8-9-26(25,15-5-4-10-32(12-15)24(33)29-16-13-34-14-16)23-17(18)11-21(30-31-23)22-19(27)6-3-7-20(22)28/h3,6-7,11,15-16,18H,4-5,8-10,12-14H2,1-2H3,(H,29,33)/t15-,18-,26-/m0/s1 |
| InChIKey | ZTDCWMXCYRCRIN-HWIKTNENSA-N |
| XLogP | 4.40 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.55 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |