C24H28F2N4O — CID 134262412
(3R)-3-[(1R,8R)-5-(2,6-difluorophenyl)-11,11-dimethyl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-trien-1-yl]-N-methylpiperidine-1-carboxamide (PubChem CID 134262412) has the molecular formula C24H28F2N4O and a molecular weight of 426.51 g/mol. Its IUPAC name is (3R)-3-[(1R,8R)-5-(2,6-difluorophenyl)-11,11-dimethyl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-trien-1-yl]-N-methylpiperidine-1-carboxamide.
| Compound Name | (3R)-3-[(1R,8R)-5-(2,6-difluorophenyl)-11,11-dimethyl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-trien-1-yl]-N-methylpiperidine-1-carboxamide |
|---|---|
| PubChem CID | 134262412 |
| Molecular Formula | C24H28F2N4O |
| Molecular Weight | 426.51 g/mol |
| Exact Mass | 426.22 |
| IUPAC Name | (3R)-3-[(1R,8R)-5-(2,6-difluorophenyl)-11,11-dimethyl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-trien-1-yl]-N-methylpiperidine-1-carboxamide |
| SMILES | CNC(=O)N1CCC[C@H]([C@@]23CC[C@@H](c4cc(-c5c(F)cccc5F)nnc42)C3(C)C)C1 |
| InChI | InChI=1S/C24H28F2N4O/c1-23(2)16-9-10-24(23,14-6-5-11-30(13-14)22(31)27-3)21-15(16)12-19(28-29-21)20-17(25)7-4-8-18(20)26/h4,7-8,12,14,16H,5-6,9-11,13H2,1-3H3,(H,27,31)/t14-,16-,24-/m0/s1 |
| InChIKey | RETVQCYYHUNQKE-ZYXJOJAPSA-N |
| XLogP | 4.63 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.51 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |