C23H27F2N5O — CID 134273990
(2S)-2-[(1S,8R)-5-(2,6-difluorophenyl)-11,11-dimethyl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-trien-1-yl]-4-methylpiperazine-1-carboxamide (PubChem CID 134273990) has the molecular formula C23H27F2N5O and a molecular weight of 427.50 g/mol. Its IUPAC name is (2S)-2-[(1S,8R)-5-(2,6-difluorophenyl)-11,11-dimethyl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-trien-1-yl]-4-methylpiperazine-1-carboxamide.
| Compound Name | (2S)-2-[(1S,8R)-5-(2,6-difluorophenyl)-11,11-dimethyl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-trien-1-yl]-4-methylpiperazine-1-carboxamide |
|---|---|
| PubChem CID | 134273990 |
| Molecular Formula | C23H27F2N5O |
| Molecular Weight | 427.50 g/mol |
| Exact Mass | 427.22 |
| IUPAC Name | (2S)-2-[(1S,8R)-5-(2,6-difluorophenyl)-11,11-dimethyl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-trien-1-yl]-4-methylpiperazine-1-carboxamide |
| SMILES | CN1CCN(C(N)=O)[C@@H]([C@@]23CC[C@@H](c4cc(-c5c(F)cccc5F)nnc42)C3(C)C)C1 |
| InChI | InChI=1S/C23H27F2N5O/c1-22(2)14-7-8-23(22,18-12-29(3)9-10-30(18)21(26)31)20-13(14)11-17(27-28-20)19-15(24)5-4-6-16(19)25/h4-6,11,14,18H,7-10,12H2,1-3H3,(H2,26,31)/t14-,18+,23-/m0/s1 |
| InChIKey | BOLZYLXSHVQHBZ-IJRIMCCZSA-N |
| XLogP | 3.27 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.50 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |