C21H20F3N3O — CID 118044731
(3,3-difluoroazetidin-1-yl)-[(1S,8S)-5-(2-fluorophenyl)-11,11-dimethyl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-trien-1-yl]methanone (PubChem CID 118044731) has the molecular formula C21H20F3N3O and a molecular weight of 387.41 g/mol. Its IUPAC name is (3,3-difluoroazetidin-1-yl)-[(1S,8S)-5-(2-fluorophenyl)-11,11-dimethyl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-trien-1-yl]methanone.
| Compound Name | (3,3-difluoroazetidin-1-yl)-[(1S,8S)-5-(2-fluorophenyl)-11,11-dimethyl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-trien-1-yl]methanone |
|---|---|
| PubChem CID | 118044731 |
| Molecular Formula | C21H20F3N3O |
| Molecular Weight | 387.41 g/mol |
| Exact Mass | 387.16 |
| IUPAC Name | (3,3-difluoroazetidin-1-yl)-[(1S,8S)-5-(2-fluorophenyl)-11,11-dimethyl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-trien-1-yl]methanone |
| SMILES | CC1(C)[C@@H]2CC[C@@]1(C(=O)N1CC(F)(F)C1)c1nnc(-c3ccccc3F)cc12 |
| InChI | InChI=1S/C21H20F3N3O/c1-19(2)14-7-8-21(19,18(28)27-10-20(23,24)11-27)17-13(14)9-16(25-26-17)12-5-3-4-6-15(12)22/h3-6,9,14H,7-8,10-11H2,1-2H3/t14-,21+/m1/s1 |
| InChIKey | IDLZMPSFXQFGRQ-SZNDQCEHSA-N |
| XLogP | 3.92 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.41 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |