C18H21BFN3O — CID 123526075
N-[(1R,8R)-5-(2-fluorophenyl)-11,11-dimethyl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-trien-1-yl]-methylboronamidic acid (PubChem CID 123526075) has the molecular formula C18H21BFN3O and a molecular weight of 325.20 g/mol. Its IUPAC name is N-[(1R,8R)-5-(2-fluorophenyl)-11,11-dimethyl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-trien-1-yl]-methylboronamidic acid.
| Compound Name | N-[(1R,8R)-5-(2-fluorophenyl)-11,11-dimethyl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-trien-1-yl]-methylboronamidic acid |
|---|---|
| PubChem CID | 123526075 |
| Molecular Formula | C18H21BFN3O |
| Molecular Weight | 325.20 g/mol |
| Exact Mass | 325.18 |
| IUPAC Name | N-[(1R,8R)-5-(2-fluorophenyl)-11,11-dimethyl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-trien-1-yl]-methylboronamidic acid |
| SMILES | CB(O)N[C@@]12CC[C@@H](c3cc(-c4ccccc4F)nnc31)C2(C)C |
| InChI | InChI=1S/C18H21BFN3O/c1-17(2)13-8-9-18(17,23-19(3)24)16-12(13)10-15(21-22-16)11-6-4-5-7-14(11)20/h4-7,10,13,23-24H,8-9H2,1-3H3/t13-,18-/m0/s1 |
| InChIKey | NZGSZXOURMODHD-UGSOOPFHSA-N |
| XLogP | 3.10 |
| TPSA | 58.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.20 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|