C20H23FN2O — CID 118044682
(1S,8S)-5-(2-fluorophenyl)-1-(2-methoxyethyl)-11,11-dimethyl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-triene (PubChem CID 118044682) has the molecular formula C20H23FN2O and a molecular weight of 326.41 g/mol. Its IUPAC name is (1S,8S)-5-(2-fluorophenyl)-1-(2-methoxyethyl)-11,11-dimethyl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-triene.
| Compound Name | (1S,8S)-5-(2-fluorophenyl)-1-(2-methoxyethyl)-11,11-dimethyl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-triene |
|---|---|
| PubChem CID | 118044682 |
| Molecular Formula | C20H23FN2O |
| Molecular Weight | 326.41 g/mol |
| Exact Mass | 326.18 |
| IUPAC Name | (1S,8S)-5-(2-fluorophenyl)-1-(2-methoxyethyl)-11,11-dimethyl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-triene |
| SMILES | COCC[C@]12CC[C@H](c3cc(-c4ccccc4F)nnc31)C2(C)C |
| InChI | InChI=1S/C20H23FN2O/c1-19(2)15-8-9-20(19,10-11-24-3)18-14(15)12-17(22-23-18)13-6-4-5-7-16(13)21/h4-7,12,15H,8-11H2,1-3H3/t15-,20-/m1/s1 |
| InChIKey | XSRAEHGYXWUGAL-FOIQADDNSA-N |
| XLogP | 4.47 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.41 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |