C20H21FN2O2 — CID 118044848
methyl (8R,10R)-5-(2-fluorophenyl)-1,11,11-trimethyl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-triene-10-carboxylate (PubChem CID 118044848) has the molecular formula C20H21FN2O2 and a molecular weight of 340.40 g/mol. Its IUPAC name is methyl (8R,10R)-5-(2-fluorophenyl)-1,11,11-trimethyl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-triene-10-carboxylate.
| Compound Name | methyl (8R,10R)-5-(2-fluorophenyl)-1,11,11-trimethyl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-triene-10-carboxylate |
|---|---|
| PubChem CID | 118044848 |
| Molecular Formula | C20H21FN2O2 |
| Molecular Weight | 340.40 g/mol |
| Exact Mass | 340.16 |
| IUPAC Name | methyl (8R,10R)-5-(2-fluorophenyl)-1,11,11-trimethyl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-triene-10-carboxylate |
| SMILES | COC(=O)[C@@H]1C[C@H]2c3cc(-c4ccccc4F)nnc3C1(C)C2(C)C |
| InChI | InChI=1S/C20H21FN2O2/c1-19(2)13-10-14(18(24)25-4)20(19,3)17-12(13)9-16(22-23-17)11-7-5-6-8-15(11)21/h5-9,13-14H,10H2,1-4H3/t13-,14-,20?/m0/s1 |
| InChIKey | RYWOLCNKGMAAGK-JWDIZXQDSA-N |
| XLogP | 3.86 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.40 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |