C22H26FN3O — CID 158271041
(1S,8S)-N-(cyclopropylmethyl)-5-(2-fluorophenyl)-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-triene-1-carboxamide;ethane (PubChem CID 158271041) has the molecular formula C22H26FN3O and a molecular weight of 367.47 g/mol. Its IUPAC name is (1S,8S)-N-(cyclopropylmethyl)-5-(2-fluorophenyl)-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-triene-1-carboxamide;ethane.
| Compound Name | (1S,8S)-N-(cyclopropylmethyl)-5-(2-fluorophenyl)-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-triene-1-carboxamide;ethane |
|---|---|
| PubChem CID | 158271041 |
| Molecular Formula | C22H26FN3O |
| Molecular Weight | 367.47 g/mol |
| Exact Mass | 367.21 |
| IUPAC Name | (1S,8S)-N-(cyclopropylmethyl)-5-(2-fluorophenyl)-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-triene-1-carboxamide;ethane |
| SMILES | CC.O=C(NCC1CC1)[C@@]12CC[C@@H](C1)c1cc(-c3ccccc3F)nnc12 |
| InChI | InChI=1S/C20H20FN3O.C2H6/c21-16-4-2-1-3-14(16)17-9-15-13-7-8-20(10-13,18(15)24-23-17)19(25)22-11-12-5-6-12;1-2/h1-4,9,12-13H,5-8,10-11H2,(H,22,25);1-2H3/t13-,20-;/m0./s1 |
| InChIKey | GJAKZZRAORUFNG-MWQMLZFGSA-N |
| XLogP | 4.35 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.47 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |