C28H33Br2FN2O — CID 157174337
(1R,4R)-7-(bromomethyl)-1,7-dimethylbicyclo[2.2.1]heptan-2-one;(1R,8R)-11-(bromomethyl)-5-(2-fluorophenyl)-1,11-dimethyl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-triene (PubChem CID 157174337) has the molecular formula C28H33Br2FN2O and a molecular weight of 592.39 g/mol. Its IUPAC name is (1R,4R)-7-(bromomethyl)-1,7-dimethylbicyclo[2.2.1]heptan-2-one;(1R,8R)-11-(bromomethyl)-5-(2-fluorophenyl)-1,11-dimethyl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-triene.
| Compound Name | (1R,4R)-7-(bromomethyl)-1,7-dimethylbicyclo[2.2.1]heptan-2-one;(1R,8R)-11-(bromomethyl)-5-(2-fluorophenyl)-1,11-dimethyl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-triene |
|---|---|
| PubChem CID | 157174337 |
| Molecular Formula | C28H33Br2FN2O |
| Molecular Weight | 592.39 g/mol |
| Exact Mass | 590.09 |
| IUPAC Name | (1R,4R)-7-(bromomethyl)-1,7-dimethylbicyclo[2.2.1]heptan-2-one;(1R,8R)-11-(bromomethyl)-5-(2-fluorophenyl)-1,11-dimethyl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-triene |
| SMILES | CC1(CBr)[C@@H]2CC[C@@]1(C)C(=O)C2.CC1(CBr)[C@@H]2CC[C@@]1(C)c1nnc(-c3ccccc3F)cc12 |
| InChI | InChI=1S/C18H18BrFN2.C10H15BrO/c1-17-8-7-13(18(17,2)10-19)12-9-15(21-22-16(12)17)11-5-3-4-6-14(11)20;1-9-4-3-7(5-8(9)12)10(9,2)6-11/h3-6,9,13H,7-8,10H2,1-2H3;7H,3-6H2,1-2H3/t13-,17+,18?;7-,9+,10?/m11/s1 |
| InChIKey | ANVHLBYUAYDWQY-QLILLZFJSA-N |
| XLogP | 7.61 |
| TPSA | 42.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.39 |
| LogP ≤ 5 | 7.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|