C22H23FN4 — CID 123339954
5-(2-fluorophenyl)-11,11-dimethyl-1-[(3-methylpyrazol-1-yl)methyl]-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-triene (PubChem CID 123339954) has the molecular formula C22H23FN4 and a molecular weight of 362.45 g/mol. Its IUPAC name is 5-(2-fluorophenyl)-11,11-dimethyl-1-[(3-methylpyrazol-1-yl)methyl]-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-triene.
| Compound Name | 5-(2-fluorophenyl)-11,11-dimethyl-1-[(3-methylpyrazol-1-yl)methyl]-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-triene |
|---|---|
| PubChem CID | 123339954 |
| Molecular Formula | C22H23FN4 |
| Molecular Weight | 362.45 g/mol |
| Exact Mass | 362.19 |
| IUPAC Name | 5-(2-fluorophenyl)-11,11-dimethyl-1-[(3-methylpyrazol-1-yl)methyl]-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-triene |
| SMILES | Cc1ccn(CC23CCC(c4cc(-c5ccccc5F)nnc42)C3(C)C)n1 |
| InChI | InChI=1S/C22H23FN4/c1-14-9-11-27(26-14)13-22-10-8-17(21(22,2)3)16-12-19(24-25-20(16)22)15-6-4-5-7-18(15)23/h4-7,9,11-12,17H,8,10,13H2,1-3H3 |
| InChIKey | ISFJSDSHJUKVQM-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.45 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |