C26H25F4N3O2S — CID 134324588
N-[[(1S,8R)-5-(2,6-difluorophenyl)-11,11-dimethyl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-trien-1-yl]methyl]-N-ethyl-2,6-difluorobenzenesulfonamide (PubChem CID 134324588) has the molecular formula C26H25F4N3O2S and a molecular weight of 519.56 g/mol. Its IUPAC name is N-[[(1S,8R)-5-(2,6-difluorophenyl)-11,11-dimethyl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-trien-1-yl]methyl]-N-ethyl-2,6-difluorobenzenesulfonamide.
| Compound Name | N-[[(1S,8R)-5-(2,6-difluorophenyl)-11,11-dimethyl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-trien-1-yl]methyl]-N-ethyl-2,6-difluorobenzenesulfonamide |
|---|---|
| PubChem CID | 134324588 |
| Molecular Formula | C26H25F4N3O2S |
| Molecular Weight | 519.56 g/mol |
| Exact Mass | 519.16 |
| IUPAC Name | N-[[(1S,8R)-5-(2,6-difluorophenyl)-11,11-dimethyl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-trien-1-yl]methyl]-N-ethyl-2,6-difluorobenzenesulfonamide |
| SMILES | CCN(C[C@@]12CC[C@@H](c3cc(-c4c(F)cccc4F)nnc31)C2(C)C)S(=O)(=O)c1c(F)cccc1F |
| InChI | InChI=1S/C26H25F4N3O2S/c1-4-33(36(34,35)23-19(29)9-6-10-20(23)30)14-26-12-11-16(25(26,2)3)15-13-21(31-32-24(15)26)22-17(27)7-5-8-18(22)28/h5-10,13,16H,4,11-12,14H2,1-3H3/t16-,26-/m0/s1 |
| InChIKey | SBMXJXLNUWJUHQ-QMTYFTJSSA-N |
| XLogP | 5.57 |
| TPSA | 63.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.56 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |