C27H27F4N3O3S — CID 134324640
4-(difluoromethoxy)-N-[[(1S,8R)-5-(2,6-difluorophenyl)-11,11-dimethyl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-trien-1-yl]methyl]-N-ethylbenzenesulfonamide (PubChem CID 134324640) has the molecular formula C27H27F4N3O3S and a molecular weight of 549.59 g/mol. Its IUPAC name is 4-(difluoromethoxy)-N-[[(1S,8R)-5-(2,6-difluorophenyl)-11,11-dimethyl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-trien-1-yl]methyl]-N-ethylbenzenesulfonamide.
| Compound Name | 4-(difluoromethoxy)-N-[[(1S,8R)-5-(2,6-difluorophenyl)-11,11-dimethyl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-trien-1-yl]methyl]-N-ethylbenzenesulfonamide |
|---|---|
| PubChem CID | 134324640 |
| Molecular Formula | C27H27F4N3O3S |
| Molecular Weight | 549.59 g/mol |
| Exact Mass | 549.17 |
| IUPAC Name | 4-(difluoromethoxy)-N-[[(1S,8R)-5-(2,6-difluorophenyl)-11,11-dimethyl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-trien-1-yl]methyl]-N-ethylbenzenesulfonamide |
| SMILES | CCN(C[C@@]12CC[C@@H](c3cc(-c4c(F)cccc4F)nnc31)C2(C)C)S(=O)(=O)c1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C27H27F4N3O3S/c1-4-34(38(35,36)17-10-8-16(9-11-17)37-25(30)31)15-27-13-12-19(26(27,2)3)18-14-22(32-33-24(18)27)23-20(28)6-5-7-21(23)29/h5-11,14,19,25H,4,12-13,15H2,1-3H3/t19-,27-/m0/s1 |
| InChIKey | MYITZYRPJKUUHU-PPHZAIPVSA-N |
| XLogP | 5.89 |
| TPSA | 72.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.59 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |