C19H17F2N3 — CID 140845490
(1S,8R)-5-(2,6-difluorophenyl)-1-(isocyanomethyl)-11,11-dimethyl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-triene (PubChem CID 140845490) has the molecular formula C19H17F2N3 and a molecular weight of 325.36 g/mol. Its IUPAC name is (1S,8R)-5-(2,6-difluorophenyl)-1-(isocyanomethyl)-11,11-dimethyl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-triene.
| Compound Name | (1S,8R)-5-(2,6-difluorophenyl)-1-(isocyanomethyl)-11,11-dimethyl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-triene |
|---|---|
| PubChem CID | 140845490 |
| Molecular Formula | C19H17F2N3 |
| Molecular Weight | 325.36 g/mol |
| Exact Mass | 325.14 |
| IUPAC Name | (1S,8R)-5-(2,6-difluorophenyl)-1-(isocyanomethyl)-11,11-dimethyl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-triene |
| SMILES | [C-]#[N+]C[C@@]12CC[C@@H](c3cc(-c4c(F)cccc4F)nnc31)C2(C)C |
| InChI | InChI=1S/C19H17F2N3/c1-18(2)12-7-8-19(18,10-22-3)17-11(12)9-15(23-24-17)16-13(20)5-4-6-14(16)21/h4-6,9,12H,7-8,10H2,1-2H3/t12-,19-/m0/s1 |
| InChIKey | NIBRAPWOXRISLQ-BUXKBTBVSA-N |
| XLogP | 4.50 |
| TPSA | 30.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.36 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|