C22H23F2N3O — CID 134545460
1-[[(8R)-5-(2,6-difluorophenyl)-11,11-dimethyl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-trien-1-yl]methyl]pyrrolidin-2-one (PubChem CID 134545460) has the molecular formula C22H23F2N3O and a molecular weight of 383.44 g/mol. Its IUPAC name is 1-[[(8R)-5-(2,6-difluorophenyl)-11,11-dimethyl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-trien-1-yl]methyl]pyrrolidin-2-one.
| Compound Name | 1-[[(8R)-5-(2,6-difluorophenyl)-11,11-dimethyl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-trien-1-yl]methyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 134545460 |
| Molecular Formula | C22H23F2N3O |
| Molecular Weight | 383.44 g/mol |
| Exact Mass | 383.18 |
| IUPAC Name | 1-[[(8R)-5-(2,6-difluorophenyl)-11,11-dimethyl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-trien-1-yl]methyl]pyrrolidin-2-one |
| SMILES | CC1(C)[C@H]2CCC1(CN1CCCC1=O)c1nnc(-c3c(F)cccc3F)cc12 |
| InChI | InChI=1S/C22H23F2N3O/c1-21(2)14-8-9-22(21,12-27-10-4-7-18(27)28)20-13(14)11-17(25-26-20)19-15(23)5-3-6-16(19)24/h3,5-6,11,14H,4,7-10,12H2,1-2H3/t14-,22?/m0/s1 |
| InChIKey | UHGKOTGVCUKJFH-XLEXHMCLSA-N |
| XLogP | 4.20 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.44 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |