C29H36F2N4O — CID 145182927
N-[[(1S,8R)-5-(2,6-difluorophenyl)-11,11-dimethyl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-trien-1-yl]methyl]-2-(3,3-dimethylbut-1-en-2-ylimino)-N-ethylpropanamide (PubChem CID 145182927) has the molecular formula C29H36F2N4O and a molecular weight of 494.63 g/mol. Its IUPAC name is N-[[(1S,8R)-5-(2,6-difluorophenyl)-11,11-dimethyl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-trien-1-yl]methyl]-2-(3,3-dimethylbut-1-en-2-ylimino)-N-ethylpropanamide.
| Compound Name | N-[[(1S,8R)-5-(2,6-difluorophenyl)-11,11-dimethyl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-trien-1-yl]methyl]-2-(3,3-dimethylbut-1-en-2-ylimino)-N-ethylpropanamide |
|---|---|
| PubChem CID | 145182927 |
| Molecular Formula | C29H36F2N4O |
| Molecular Weight | 494.63 g/mol |
| Exact Mass | 494.29 |
| IUPAC Name | N-[[(1S,8R)-5-(2,6-difluorophenyl)-11,11-dimethyl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-trien-1-yl]methyl]-2-(3,3-dimethylbut-1-en-2-ylimino)-N-ethylpropanamide |
| SMILES | C=C(/N=C(\C)C(=O)N(CC)C[C@@]12CC[C@@H](c3cc(-c4c(F)cccc4F)nnc31)C2(C)C)C(C)(C)C |
| InChI | InChI=1S/C29H36F2N4O/c1-9-35(26(36)17(2)32-18(3)27(4,5)6)16-29-14-13-20(28(29,7)8)19-15-23(33-34-25(19)29)24-21(30)11-10-12-22(24)31/h10-12,15,20H,3,9,13-14,16H2,1-2,4-8H3/b32-17+/t20-,29-/m0/s1 |
| InChIKey | LGUMPOWVOAMKFH-ANXRVQQYSA-N |
| XLogP | 6.45 |
| TPSA | 58.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.63 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|