C24H26F2N4O — CID 123407081
2-cyano-N-[[5-(2,6-difluorophenyl)-10,10-dimethyl-3,4-diazatricyclo[6.2.2.02,7]dodeca-2,4,6-trien-1-yl]methyl]-N-ethylacetamide (PubChem CID 123407081) has the molecular formula C24H26F2N4O and a molecular weight of 424.50 g/mol. Its IUPAC name is 2-cyano-N-[[5-(2,6-difluorophenyl)-10,10-dimethyl-3,4-diazatricyclo[6.2.2.02,7]dodeca-2,4,6-trien-1-yl]methyl]-N-ethylacetamide.
| Compound Name | 2-cyano-N-[[5-(2,6-difluorophenyl)-10,10-dimethyl-3,4-diazatricyclo[6.2.2.02,7]dodeca-2,4,6-trien-1-yl]methyl]-N-ethylacetamide |
|---|---|
| PubChem CID | 123407081 |
| Molecular Formula | C24H26F2N4O |
| Molecular Weight | 424.50 g/mol |
| Exact Mass | 424.21 |
| IUPAC Name | 2-cyano-N-[[5-(2,6-difluorophenyl)-10,10-dimethyl-3,4-diazatricyclo[6.2.2.02,7]dodeca-2,4,6-trien-1-yl]methyl]-N-ethylacetamide |
| SMILES | CCN(CC12CCC(CC1(C)C)c1cc(-c3c(F)cccc3F)nnc12)C(=O)CC#N |
| InChI | InChI=1S/C24H26F2N4O/c1-4-30(20(31)9-11-27)14-24-10-8-15(13-23(24,2)3)16-12-19(28-29-22(16)24)21-17(25)6-5-7-18(21)26/h5-7,12,15H,4,8-10,13-14H2,1-3H3 |
| InChIKey | VSPWCGREMJQLFC-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 69.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.50 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |