C24H25F2N5O — CID 134324685
N-[[(1S,8R)-5-(2,6-difluorophenyl)-11,11-dimethyl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-trien-1-yl]methyl]-N-ethyl-1H-pyrazole-4-carboxamide (PubChem CID 134324685) has the molecular formula C24H25F2N5O and a molecular weight of 437.49 g/mol. Its IUPAC name is N-[[(1S,8R)-5-(2,6-difluorophenyl)-11,11-dimethyl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-trien-1-yl]methyl]-N-ethyl-1H-pyrazole-4-carboxamide.
| Compound Name | N-[[(1S,8R)-5-(2,6-difluorophenyl)-11,11-dimethyl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-trien-1-yl]methyl]-N-ethyl-1H-pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 134324685 |
| Molecular Formula | C24H25F2N5O |
| Molecular Weight | 437.49 g/mol |
| Exact Mass | 437.20 |
| IUPAC Name | N-[[(1S,8R)-5-(2,6-difluorophenyl)-11,11-dimethyl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-trien-1-yl]methyl]-N-ethyl-1H-pyrazole-4-carboxamide |
| SMILES | CCN(C[C@@]12CC[C@@H](c3cc(-c4c(F)cccc4F)nnc31)C2(C)C)C(=O)c1cn[nH]c1 |
| InChI | InChI=1S/C24H25F2N5O/c1-4-31(22(32)14-11-27-28-12-14)13-24-9-8-16(23(24,2)3)15-10-19(29-30-21(15)24)20-17(25)6-5-7-18(20)26/h5-7,10-12,16H,4,8-9,13H2,1-3H3,(H,27,28)/t16-,24-/m0/s1 |
| InChIKey | QVDBDIGQCCOIIO-FYSMJZIKSA-N |
| XLogP | 4.46 |
| TPSA | 74.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.49 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |