C24H26F2N4O2 — CID 118044687
(2S)-N-(2-cyanoethyl)-N-[[(1S,8R)-5-(2,6-difluorophenyl)-11,11-dimethyl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-trien-1-yl]methyl]-2-hydroxypropanamide (PubChem CID 118044687) has the molecular formula C24H26F2N4O2 and a molecular weight of 440.49 g/mol. Its IUPAC name is (2S)-N-(2-cyanoethyl)-N-[[(1S,8R)-5-(2,6-difluorophenyl)-11,11-dimethyl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-trien-1-yl]methyl]-2-hydroxypropanamide.
| Compound Name | (2S)-N-(2-cyanoethyl)-N-[[(1S,8R)-5-(2,6-difluorophenyl)-11,11-dimethyl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-trien-1-yl]methyl]-2-hydroxypropanamide |
|---|---|
| PubChem CID | 118044687 |
| Molecular Formula | C24H26F2N4O2 |
| Molecular Weight | 440.49 g/mol |
| Exact Mass | 440.20 |
| IUPAC Name | (2S)-N-(2-cyanoethyl)-N-[[(1S,8R)-5-(2,6-difluorophenyl)-11,11-dimethyl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-trien-1-yl]methyl]-2-hydroxypropanamide |
| SMILES | C[C@H](O)C(=O)N(CCC#N)C[C@@]12CC[C@@H](c3cc(-c4c(F)cccc4F)nnc31)C2(C)C |
| InChI | InChI=1S/C24H26F2N4O2/c1-14(31)22(32)30(11-5-10-27)13-24-9-8-16(23(24,2)3)15-12-19(28-29-21(15)24)20-17(25)6-4-7-18(20)26/h4,6-7,12,14,16,31H,5,8-9,11,13H2,1-3H3/t14-,16-,24-/m0/s1 |
| InChIKey | IECWPEHOAGHLMQ-ZYXJOJAPSA-N |
| XLogP | 3.70 |
| TPSA | 90.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.49 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |