C27H29F2N3O2S — CID 134324642
N-[[(1S,8R)-5-(2,6-difluorophenyl)-11,11-dimethyl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-trien-1-yl]methyl]-N-ethyl-1-phenylmethanesulfonamide (PubChem CID 134324642) has the molecular formula C27H29F2N3O2S and a molecular weight of 497.61 g/mol. Its IUPAC name is N-[[(1S,8R)-5-(2,6-difluorophenyl)-11,11-dimethyl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-trien-1-yl]methyl]-N-ethyl-1-phenylmethanesulfonamide.
| Compound Name | N-[[(1S,8R)-5-(2,6-difluorophenyl)-11,11-dimethyl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-trien-1-yl]methyl]-N-ethyl-1-phenylmethanesulfonamide |
|---|---|
| PubChem CID | 134324642 |
| Molecular Formula | C27H29F2N3O2S |
| Molecular Weight | 497.61 g/mol |
| Exact Mass | 497.19 |
| IUPAC Name | N-[[(1S,8R)-5-(2,6-difluorophenyl)-11,11-dimethyl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-trien-1-yl]methyl]-N-ethyl-1-phenylmethanesulfonamide |
| SMILES | CCN(C[C@@]12CC[C@@H](c3cc(-c4c(F)cccc4F)nnc31)C2(C)C)S(=O)(=O)Cc1ccccc1 |
| InChI | InChI=1S/C27H29F2N3O2S/c1-4-32(35(33,34)16-18-9-6-5-7-10-18)17-27-14-13-20(26(27,2)3)19-15-23(30-31-25(19)27)24-21(28)11-8-12-22(24)29/h5-12,15,20H,4,13-14,16-17H2,1-3H3/t20-,27-/m0/s1 |
| InChIKey | CAFFDGZBKSPCIS-DCFHFQCYSA-N |
| XLogP | 5.43 |
| TPSA | 63.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.61 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |