C19H18FN3 — CID 118044743
2-[(1S,8S)-5-(2-fluorophenyl)-11,11-dimethyl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-trien-1-yl]acetonitrile (PubChem CID 118044743) has the molecular formula C19H18FN3 and a molecular weight of 307.37 g/mol. Its IUPAC name is 2-[(1S,8S)-5-(2-fluorophenyl)-11,11-dimethyl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-trien-1-yl]acetonitrile.
| Compound Name | 2-[(1S,8S)-5-(2-fluorophenyl)-11,11-dimethyl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-trien-1-yl]acetonitrile |
|---|---|
| PubChem CID | 118044743 |
| Molecular Formula | C19H18FN3 |
| Molecular Weight | 307.37 g/mol |
| Exact Mass | 307.15 |
| IUPAC Name | 2-[(1S,8S)-5-(2-fluorophenyl)-11,11-dimethyl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-trien-1-yl]acetonitrile |
| SMILES | CC1(C)[C@@H]2CC[C@@]1(CC#N)c1nnc(-c3ccccc3F)cc12 |
| InChI | InChI=1S/C19H18FN3/c1-18(2)14-7-8-19(18,9-10-21)17-13(14)11-16(22-23-17)12-5-3-4-6-15(12)20/h3-6,11,14H,7-9H2,1-2H3/t14-,19-/m1/s1 |
| InChIKey | JFMIOWJYOVEWKL-AUUYWEPGSA-N |
| XLogP | 4.35 |
| TPSA | 49.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.37 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |