C24H20FN5O — CID 134545457
(8S)-N-(5-cyano-2-pyridinyl)-5-(2-fluorophenyl)-11,11-dimethyl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-triene-1-carboxamide (PubChem CID 134545457) has the molecular formula C24H20FN5O and a molecular weight of 413.46 g/mol. Its IUPAC name is (8S)-N-(5-cyano-2-pyridinyl)-5-(2-fluorophenyl)-11,11-dimethyl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-triene-1-carboxamide.
| Compound Name | (8S)-N-(5-cyano-2-pyridinyl)-5-(2-fluorophenyl)-11,11-dimethyl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-triene-1-carboxamide |
|---|---|
| PubChem CID | 134545457 |
| Molecular Formula | C24H20FN5O |
| Molecular Weight | 413.46 g/mol |
| Exact Mass | 413.17 |
| IUPAC Name | (8S)-N-(5-cyano-2-pyridinyl)-5-(2-fluorophenyl)-11,11-dimethyl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-triene-1-carboxamide |
| SMILES | CC1(C)[C@@H]2CCC1(C(=O)Nc1ccc(C#N)cn1)c1nnc(-c3ccccc3F)cc12 |
| InChI | InChI=1S/C24H20FN5O/c1-23(2)17-9-10-24(23,22(31)28-20-8-7-14(12-26)13-27-20)21-16(17)11-19(29-30-21)15-5-3-4-6-18(15)25/h3-8,11,13,17H,9-10H2,1-2H3,(H,27,28,31)/t17-,24?/m1/s1 |
| InChIKey | GPAOAERZQCVVJA-BPNWFJGMSA-N |
| XLogP | 4.34 |
| TPSA | 91.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.46 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |