C16H14F2N4 — CID 153426747
(1R,8R)-5-(2,6-difluorophenyl)-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-triene-1-carboximidamide (PubChem CID 153426747) has the molecular formula C16H14F2N4 and a molecular weight of 300.31 g/mol. Its IUPAC name is (1R,8R)-5-(2,6-difluorophenyl)-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-triene-1-carboximidamide.
| Compound Name | (1R,8R)-5-(2,6-difluorophenyl)-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-triene-1-carboximidamide |
|---|---|
| PubChem CID | 153426747 |
| Molecular Formula | C16H14F2N4 |
| Molecular Weight | 300.31 g/mol |
| Exact Mass | 300.12 |
| IUPAC Name | (1R,8R)-5-(2,6-difluorophenyl)-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-triene-1-carboximidamide |
| SMILES | [H]/N=C(\N)[C@]12CC[C@H](C1)c1cc(-c3c(F)cccc3F)nnc12 |
| InChI | InChI=1S/C16H14F2N4/c17-10-2-1-3-11(18)13(10)12-6-9-8-4-5-16(7-8,15(19)20)14(9)22-21-12/h1-3,6,8H,4-5,7H2,(H3,19,20)/t8-,16-/m1/s1 |
| InChIKey | PWUQRHALQAIZBL-VPTHRUTESA-N |
| XLogP | 2.88 |
| TPSA | 75.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.31 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|