C20H16F3N3O — CID 134545734
(3,3-difluoroazetidin-1-yl)-[(1S,8S)-5-(2-fluorophenyl)-11-methylidene-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-trien-1-yl]methanone (PubChem CID 134545734) has the molecular formula C20H16F3N3O and a molecular weight of 371.36 g/mol. Its IUPAC name is (3,3-difluoroazetidin-1-yl)-[(1S,8S)-5-(2-fluorophenyl)-11-methylidene-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-trien-1-yl]methanone.
| Compound Name | (3,3-difluoroazetidin-1-yl)-[(1S,8S)-5-(2-fluorophenyl)-11-methylidene-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-trien-1-yl]methanone |
|---|---|
| PubChem CID | 134545734 |
| Molecular Formula | C20H16F3N3O |
| Molecular Weight | 371.36 g/mol |
| Exact Mass | 371.12 |
| IUPAC Name | (3,3-difluoroazetidin-1-yl)-[(1S,8S)-5-(2-fluorophenyl)-11-methylidene-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-trien-1-yl]methanone |
| SMILES | C=C1[C@@H]2CC[C@@]1(C(=O)N1CC(F)(F)C1)c1nnc(-c3ccccc3F)cc12 |
| InChI | InChI=1S/C20H16F3N3O/c1-11-12-6-7-20(11,18(27)26-9-19(22,23)10-26)17-14(12)8-16(24-25-17)13-4-2-3-5-15(13)21/h2-5,8,12H,1,6-7,9-10H2/t12-,20-/m0/s1 |
| InChIKey | NUWCNFMMOLQBCA-YUNKPMOVSA-N |
| XLogP | 3.45 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.36 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|