C22H25F2N3O2 — CID 134262393
2-[[(1R,8S)-5-(2,6-difluorophenyl)-11,11-dimethyl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-trien-1-yl]oxy]pentanamide (PubChem CID 134262393) has the molecular formula C22H25F2N3O2 and a molecular weight of 401.46 g/mol. Its IUPAC name is 2-[[(1R,8S)-5-(2,6-difluorophenyl)-11,11-dimethyl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-trien-1-yl]oxy]pentanamide.
| Compound Name | 2-[[(1R,8S)-5-(2,6-difluorophenyl)-11,11-dimethyl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-trien-1-yl]oxy]pentanamide |
|---|---|
| PubChem CID | 134262393 |
| Molecular Formula | C22H25F2N3O2 |
| Molecular Weight | 401.46 g/mol |
| Exact Mass | 401.19 |
| IUPAC Name | 2-[[(1R,8S)-5-(2,6-difluorophenyl)-11,11-dimethyl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-trien-1-yl]oxy]pentanamide |
| SMILES | CCCC(O[C@@]12CC[C@@H](c3cc(-c4c(F)cccc4F)nnc31)C2(C)C)C(N)=O |
| InChI | InChI=1S/C22H25F2N3O2/c1-4-6-17(20(25)28)29-22-10-9-13(21(22,2)3)12-11-16(26-27-19(12)22)18-14(23)7-5-8-15(18)24/h5,7-8,11,13,17H,4,6,9-10H2,1-3H3,(H2,25,28)/t13-,17?,22-/m0/s1 |
| InChIKey | YOOGGSBRCSDSKJ-SSJNCOEUSA-N |
| XLogP | 4.20 |
| TPSA | 78.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.46 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |