C21H22F2IN2O3- — CID 163543078
CID 163543078 (PubChem CID 163543078) has the molecular formula C21H22F2IN2O3- and a molecular weight of 515.32 g/mol.
| Compound Name | CID 163543078 |
|---|---|
| PubChem CID | 163543078 |
| Molecular Formula | C21H22F2IN2O3- |
| Molecular Weight | 515.32 g/mol |
| Exact Mass | 515.06 |
| IUPAC Name | — |
| SMILES | CC[C@@H](O[C@]12C[I-]C[C@H](c3cc(-c4c(F)cccc4F)nnc31)C2(C)C)C(=O)O |
| InChI | InChI=1S/C21H22F2IN2O3/c1-4-16(19(27)28)29-21-10-24-9-12(20(21,2)3)11-8-15(25-26-18(11)21)17-13(22)6-5-7-14(17)23/h5-8,12,16H,4,9-10H2,1-3H3,(H,27,28)/q-1/t12-,16-,21-/m1/s1 |
| InChIKey | ZQZKUIJZGHAKTD-YDZGXFTCSA-N |
| XLogP | 0.72 |
| TPSA | 72.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.32 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|