C28H28F2IN6O- — CID 142341467
CID 142341467 (PubChem CID 142341467) has the molecular formula C28H28F2IN6O- and a molecular weight of 629.47 g/mol.
| Compound Name | CID 142341467 |
|---|---|
| PubChem CID | 142341467 |
| Molecular Formula | C28H28F2IN6O- |
| Molecular Weight | 629.47 g/mol |
| Exact Mass | 629.13 |
| IUPAC Name | — |
| SMILES | Cc1cc(-c2cncc([C@@]34C[I-]C[C@@H](c5cc(-c6c(F)cccc6F)nnc53)C4(C)C)n2)nn1C[C@@H](C)O |
| InChI | InChI=1S/C28H28F2IN6O/c1-15-8-21(36-37(15)13-16(2)38)23-11-32-12-24(33-23)28-14-31-10-18(27(28,3)4)17-9-22(34-35-26(17)28)25-19(29)6-5-7-20(25)30/h5-9,11-12,16,18,38H,10,13-14H2,1-4H3/q-1/t16-,18+,28+/m1/s1 |
| InChIKey | WHEDTJQIIYYTFJ-AUPSIVQCSA-N |
| XLogP | 1.28 |
| TPSA | 89.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.47 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|