C24H22F2IN4O- — CID 163590190
CID 163590190 (PubChem CID 163590190) has the molecular formula C24H22F2IN4O- and a molecular weight of 547.37 g/mol.
| Compound Name | CID 163590190 |
|---|---|
| PubChem CID | 163590190 |
| Molecular Formula | C24H22F2IN4O- |
| Molecular Weight | 547.37 g/mol |
| Exact Mass | 547.08 |
| IUPAC Name | — |
| SMILES | CC(=O)Nc1cccc([C@@]23C[I-]C[C@@H](c4cc(-c5c(F)cccc5F)nnc42)C3(C)C)n1 |
| InChI | InChI=1S/C24H22F2IN4O/c1-13(32)28-20-9-5-8-19(29-20)24-12-27-11-15(23(24,2)3)14-10-18(30-31-22(14)24)21-16(25)6-4-7-17(21)26/h4-10,15H,11-12H2,1-3H3,(H,28,29,32)/q-1/t15-,24-/m0/s1 |
| InChIKey | CCBOLIKIYLQTRI-OWJWWREXSA-N |
| XLogP | 1.29 |
| TPSA | 67.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.37 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|