C31H35F2IN5O2- — CID 148672028
CID 148672028 (PubChem CID 148672028) has the molecular formula C31H35F2IN5O2- and a molecular weight of 674.55 g/mol.
| Compound Name | CID 148672028 |
|---|---|
| PubChem CID | 148672028 |
| Molecular Formula | C31H35F2IN5O2- |
| Molecular Weight | 674.55 g/mol |
| Exact Mass | 674.18 |
| IUPAC Name | — |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@@H](c2nccc([C@@]34C[I-]C[C@@H](c5cc(-c6c(F)cccc6F)nnc53)C4(C)C)n2)C1 |
| InChI | InChI=1S/C31H35F2IN5O2/c1-29(2,3)41-28(40)39-13-7-8-18(16-39)27-35-12-11-24(36-27)31-17-34-15-20(30(31,4)5)19-14-23(37-38-26(19)31)25-21(32)9-6-10-22(25)33/h6,9-12,14,18,20H,7-8,13,15-17H2,1-5H3/q-1/t18-,20+,31+/m1/s1 |
| InChIKey | QDZMTOVJPKQTSO-URWSEJSBSA-N |
| XLogP | 2.84 |
| TPSA | 81.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.55 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|