C23H18F5N3O3S — CID 122672724
[2-[(1S,8R)-5-(2,6-difluorophenyl)-11,11-dimethyl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-trien-1-yl]-4-pyridinyl] trifluoromethanesulfonate (PubChem CID 122672724) has the molecular formula C23H18F5N3O3S and a molecular weight of 511.47 g/mol. Its IUPAC name is [2-[(1S,8R)-5-(2,6-difluorophenyl)-11,11-dimethyl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-trien-1-yl]-4-pyridinyl] trifluoromethanesulfonate.
| Compound Name | [2-[(1S,8R)-5-(2,6-difluorophenyl)-11,11-dimethyl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-trien-1-yl]-4-pyridinyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 122672724 |
| Molecular Formula | C23H18F5N3O3S |
| Molecular Weight | 511.47 g/mol |
| Exact Mass | 511.10 |
| IUPAC Name | [2-[(1S,8R)-5-(2,6-difluorophenyl)-11,11-dimethyl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-trien-1-yl]-4-pyridinyl] trifluoromethanesulfonate |
| SMILES | CC1(C)[C@H]2CC[C@]1(c1cc(OS(=O)(=O)C(F)(F)F)ccn1)c1nnc(-c3c(F)cccc3F)cc12 |
| InChI | InChI=1S/C23H18F5N3O3S/c1-21(2)14-6-8-22(21,18-10-12(7-9-29-18)34-35(32,33)23(26,27)28)20-13(14)11-17(30-31-20)19-15(24)4-3-5-16(19)25/h3-5,7,9-11,14H,6,8H2,1-2H3/t14-,22-/m0/s1 |
| InChIKey | KKMFAFPLZRLPNC-FPTDNZKUSA-N |
| XLogP | 5.25 |
| TPSA | 82.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.47 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|