C26H26F2N4O3S — CID 135287956
6-[(1S,8R)-5-(2,6-difluorophenyl)-11,11-dimethyl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-trien-1-yl]-N-(2-methylsulfonylethyl)pyridine-2-carboxamide (PubChem CID 135287956) has the molecular formula C26H26F2N4O3S and a molecular weight of 512.58 g/mol. Its IUPAC name is 6-[(1S,8R)-5-(2,6-difluorophenyl)-11,11-dimethyl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-trien-1-yl]-N-(2-methylsulfonylethyl)pyridine-2-carboxamide.
| Compound Name | 6-[(1S,8R)-5-(2,6-difluorophenyl)-11,11-dimethyl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-trien-1-yl]-N-(2-methylsulfonylethyl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 135287956 |
| Molecular Formula | C26H26F2N4O3S |
| Molecular Weight | 512.58 g/mol |
| Exact Mass | 512.17 |
| IUPAC Name | 6-[(1S,8R)-5-(2,6-difluorophenyl)-11,11-dimethyl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-trien-1-yl]-N-(2-methylsulfonylethyl)pyridine-2-carboxamide |
| SMILES | CC1(C)[C@H]2CC[C@]1(c1cccc(C(=O)NCCS(C)(=O)=O)n1)c1nnc(-c3c(F)cccc3F)cc12 |
| InChI | InChI=1S/C26H26F2N4O3S/c1-25(2)16-10-11-26(25,21-9-5-8-19(30-21)24(33)29-12-13-36(3,34)35)23-15(16)14-20(31-32-23)22-17(27)6-4-7-18(22)28/h4-9,14,16H,10-13H2,1-3H3,(H,29,33)/t16-,26-/m0/s1 |
| InChIKey | WJTJSMMINQTELV-QMTYFTJSSA-N |
| XLogP | 3.79 |
| TPSA | 101.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.58 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |